About CID 88851518
CID 88851518 (PubChem CID 88851518) has the molecular formula C25H19F6N3NaO
and a molecular weight of 514.43 g/mol.
Molecular Properties
| Compound Name | CID 88851518 |
| PubChem CID | 88851518 |
| Molecular Formula | C25H19F6N3NaO |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | — |
| SMILES | Cc1oc(C(C)(C)C)c(C#N)c1-c1nc2c(C(F)(F)F)cc(-c3ccccc3C(F)(F)F)cc2[nH]1.[Na] |
| InChI | InChI=1S/C25H19F6N3O.Na/c1-12-19(15(11-32)21(35-12)23(2,3)4)22-33-18-10-13(9-17(20(18)34-22)25(29,30)31)14-7-5-6-8-16(14)24(26,27)28;/h5-10H,1-4H3,(H,33,34); |
| InChIKey | VPRCTKRIWGCFQS-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 88851518 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88851518?
The IUPAC name of CID 88851518 (CID 88851518) is not available.
What is the SMILES notation for CID 88851518?
The canonical SMILES for CID 88851518 is Cc1oc(C(C)(C)C)c(C#N)c1-c1nc2c(C(F)(F)F)cc(-c3ccccc3C(F)(F)F)cc2[nH]1.[Na].
What is the InChIKey of CID 88851518?
The InChIKey is VPRCTKRIWGCFQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19F6N3O.Na/c1-12-19(15(11-32)21(35-12)23(2,3)4)22-33-18-10-13(9-17(20(18)34-22)25(29,30)31)14-7-5-6-8-16(14)24(26,27)28;/h5-10H,1-4H3,(H,33,34);.
What are the key properties of CID 88851518?
CID 88851518 has a molecular weight of 514.43 g/mol, XLogP of 7.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88851518 is sourced from PubChem (CID 88851518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).