C15H26O — CID 88851773
3-(2,4-dimethylcyclohexyl)cyclohexane-1-carbaldehyde (PubChem CID 88851773) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 3-(2,4-dimethylcyclohexyl)cyclohexane-1-carbaldehyde.
| Compound Name | 3-(2,4-dimethylcyclohexyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 88851773 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 3-(2,4-dimethylcyclohexyl)cyclohexane-1-carbaldehyde |
| SMILES | CC1CCC(C2CCCC(C=O)C2)C(C)C1 |
| InChI | InChI=1S/C15H26O/c1-11-6-7-15(12(2)8-11)14-5-3-4-13(9-14)10-16/h10-15H,3-9H2,1-2H3 |
| InChIKey | SYXRMCJUBYFKSA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|