C10H12ClN5O2 — CID 88852488
2-(4-chloro-1,3,5-triazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 88852488) has the molecular formula C10H12ClN5O2 and a molecular weight of 269.69 g/mol. Its IUPAC name is 2-(4-chloro-1,3,5-triazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | 2-(4-chloro-1,3,5-triazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 88852488 |
| Molecular Formula | C10H12ClN5O2 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(4-chloro-1,3,5-triazin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)N1CC2CN(c3ncnc(Cl)n3)CC2C1 |
| InChI | InChI=1S/C10H12ClN5O2/c11-8-12-5-13-9(14-8)15-1-6-3-16(10(17)18)4-7(6)2-15/h5-7H,1-4H2,(H,17,18) |
| InChIKey | UNHYIWBGCDKVJL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |