C30H27FN6O — CID 88852707
4-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]-2-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbaldehyde (PubChem CID 88852707) has the molecular formula C30H27FN6O and a molecular weight of 506.59 g/mol. Its IUPAC name is 4-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]-2-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbaldehyde.
| Compound Name | 4-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]-2-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 88852707 |
| Molecular Formula | C30H27FN6O |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 4-[4-(12-fluoro-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaen-13-yl)phenyl]-2-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carbaldehyde |
| SMILES | CN1CC2CCN(C=O)C(c3ccc(-c4c(F)cnc5[nH]c6cnc(-c7cccnc7)cc6c45)cc3)C2C1 |
| InChI | InChI=1S/C30H27FN6O/c1-36-15-21-8-10-37(17-38)29(23(21)16-36)19-6-4-18(5-7-19)27-24(31)13-34-30-28(27)22-11-25(33-14-26(22)35-30)20-3-2-9-32-12-20/h2-7,9,11-14,17,21,23,29H,8,10,15-16H2,1H3,(H,34,35) |
| InChIKey | HQHYKAYSGQLHIG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|