C21H17F3N4O3 — CID 88852819
4-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]but-3-yn-2-yl formate (PubChem CID 88852819) has the molecular formula C21H17F3N4O3 and a molecular weight of 430.39 g/mol. Its IUPAC name is 4-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]but-3-yn-2-yl formate.
| Compound Name | 4-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]but-3-yn-2-yl formate |
|---|---|
| PubChem CID | 88852819 |
| Molecular Formula | C21H17F3N4O3 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-[3-[3-(2,2,2-trifluoroethylcarbamoylamino)phenyl]imidazo[1,2-a]pyridin-7-yl]but-3-yn-2-yl formate |
| SMILES | CC(C#Cc1ccn2c(-c3cccc(NC(=O)NCC(F)(F)F)c3)cnc2c1)OC=O |
| InChI | InChI=1S/C21H17F3N4O3/c1-14(31-13-29)5-6-15-7-8-28-18(11-25-19(28)9-15)16-3-2-4-17(10-16)27-20(30)26-12-21(22,23)24/h2-4,7-11,13-14H,12H2,1H3,(H2,26,27,30) |
| InChIKey | XJUCPJXNCCCXQU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|