About 8-isocyano-1,10-phenanthroline-3-carbonitrile
8-isocyano-1,10-phenanthroline-3-carbonitrile (PubChem CID 88853098) has the molecular formula C14H6N4
and a molecular weight of 230.23 g/mol. Its IUPAC name is 8-isocyano-1,10-phenanthroline-3-carbonitrile.
Molecular Properties
| Compound Name | 8-isocyano-1,10-phenanthroline-3-carbonitrile |
| PubChem CID | 88853098 |
| Molecular Formula | C14H6N4 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 8-isocyano-1,10-phenanthroline-3-carbonitrile |
| SMILES | [C-]#[N+]c1cnc2c(ccc3cc(C#N)cnc32)c1 |
| InChI | InChI=1S/C14H6N4/c1-16-12-5-11-3-2-10-4-9(6-15)7-17-13(10)14(11)18-8-12/h2-5,7-8H |
| InChIKey | IQMXWZNMHNGLHM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 8-isocyano-1,10-phenanthroline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-isocyano-1,10-phenanthroline-3-carbonitrile?
The IUPAC name of 8-isocyano-1,10-phenanthroline-3-carbonitrile (CID 88853098) is 8-isocyano-1,10-phenanthroline-3-carbonitrile.
What is the SMILES notation for 8-isocyano-1,10-phenanthroline-3-carbonitrile?
The canonical SMILES for 8-isocyano-1,10-phenanthroline-3-carbonitrile is [C-]#[N+]c1cnc2c(ccc3cc(C#N)cnc32)c1.
What is the InChIKey of 8-isocyano-1,10-phenanthroline-3-carbonitrile?
The InChIKey is IQMXWZNMHNGLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6N4/c1-16-12-5-11-3-2-10-4-9(6-15)7-17-13(10)14(11)18-8-12/h2-5,7-8H.
What are the key properties of 8-isocyano-1,10-phenanthroline-3-carbonitrile?
8-isocyano-1,10-phenanthroline-3-carbonitrile has a molecular weight of 230.23 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-isocyano-1,10-phenanthroline-3-carbonitrile is sourced from PubChem (CID 88853098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).