About 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine
4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine (PubChem CID 88853115) has the molecular formula C31H21N5
and a molecular weight of 463.54 g/mol. Its IUPAC name is 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine.
Molecular Properties
| Compound Name | 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine |
| PubChem CID | 88853115 |
| Molecular Formula | C31H21N5 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine |
| SMILES | c1cc(-c2cc(-c3ccncc3)c(-c3ccncc3)c(-c3ccncc3)c2-c2ccncc2)ccn1 |
| InChI | InChI=1S/C31H21N5/c1-11-32-12-2-22(1)27-21-28(23-3-13-33-14-4-23)30(25-7-17-35-18-8-25)31(26-9-19-36-20-10-26)29(27)24-5-15-34-16-6-24/h1-21H |
| InChIKey | YPQNDYVSKYUJNF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine?
The IUPAC name of 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine (CID 88853115) is 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine.
What is the SMILES notation for 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine?
The canonical SMILES for 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine is c1cc(-c2cc(-c3ccncc3)c(-c3ccncc3)c(-c3ccncc3)c2-c2ccncc2)ccn1.
What is the InChIKey of 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine?
The InChIKey is YPQNDYVSKYUJNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H21N5/c1-11-32-12-2-22(1)27-21-28(23-3-13-33-14-4-23)30(25-7-17-35-18-8-25)31(26-9-19-36-20-10-26)29(27)24-5-15-34-16-6-24/h1-21H.
What are the key properties of 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine?
4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine has a molecular weight of 463.54 g/mol, XLogP of 7.00, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3,4,5-tetrapyridin-4-ylphenyl)pyridine is sourced from PubChem (CID 88853115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).