C17H22O3 — CID 88853208
1-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]oxypropan-2-yl (Z)-2-methylidenepent-3-enoate (PubChem CID 88853208) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]oxypropan-2-yl (Z)-2-methylidenepent-3-enoate.
| Compound Name | 1-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]oxypropan-2-yl (Z)-2-methylidenepent-3-enoate |
|---|---|
| PubChem CID | 88853208 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-[(3E)-3-ethenylhexa-1,3,5-trien-2-yl]oxypropan-2-yl (Z)-2-methylidenepent-3-enoate |
| SMILES | C=C/C=C(\C=C)C(=C)OCC(C)OC(=O)C(=C)/C=C\C |
| InChI | InChI=1S/C17H22O3/c1-7-10-13(4)17(18)20-14(5)12-19-15(6)16(9-3)11-8-2/h7-11,14H,2-4,6,12H2,1,5H3/b10-7-,16-11+ |
| InChIKey | FOIJTIDYGKGRFG-MDKZIDAVSA-N |
| XLogP | 3.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|