About 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione
3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione (PubChem CID 88853354) has the molecular formula C13H14O6
and a molecular weight of 266.25 g/mol. Its IUPAC name is 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione.
Molecular Properties
| Compound Name | 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione |
| PubChem CID | 88853354 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione |
| SMILES | CCOc1c(C(C(C)=O)(C(C)=O)C(C)=O)c(=O)c1=O |
| InChI | InChI=1S/C13H14O6/c1-5-19-12-9(10(17)11(12)18)13(6(2)14,7(3)15)8(4)16/h5H2,1-4H3 |
| InChIKey | LZYSEOGKVGNTCU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione?
The IUPAC name of 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione (CID 88853354) is 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione.
What is the SMILES notation for 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione?
The canonical SMILES for 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione is CCOc1c(C(C(C)=O)(C(C)=O)C(C)=O)c(=O)c1=O.
What is the InChIKey of 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione?
The InChIKey is LZYSEOGKVGNTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O6/c1-5-19-12-9(10(17)11(12)18)13(6(2)14,7(3)15)8(4)16/h5H2,1-4H3.
What are the key properties of 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione?
3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione has a molecular weight of 266.25 g/mol, XLogP of -0.31, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-3-(2-ethoxy-3,4-dioxocyclobuten-1-yl)pentane-2,4-dione is sourced from PubChem (CID 88853354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).