C9H11F5 — CID 88853533
1,1,2,3,3-pentafluoro-4,4-dimethylhepta-1,6-diene (PubChem CID 88853533) has the molecular formula C9H11F5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-4,4-dimethylhepta-1,6-diene.
| Compound Name | 1,1,2,3,3-pentafluoro-4,4-dimethylhepta-1,6-diene |
|---|---|
| PubChem CID | 88853533 |
| Molecular Formula | C9H11F5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1,1,2,3,3-pentafluoro-4,4-dimethylhepta-1,6-diene |
| SMILES | C=CCC(C)(C)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C9H11F5/c1-4-5-8(2,3)9(13,14)6(10)7(11)12/h4H,1,5H2,2-3H3 |
| InChIKey | DCZUFKRWIHCXAI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|