C13H23NO2 — CID 88853616
(2E,3Z)-N-(2,2-dimethoxyethyl)-2-ethylidene-5-methylhexa-3,5-dien-1-amine (PubChem CID 88853616) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (2E,3Z)-N-(2,2-dimethoxyethyl)-2-ethylidene-5-methylhexa-3,5-dien-1-amine.
| Compound Name | (2E,3Z)-N-(2,2-dimethoxyethyl)-2-ethylidene-5-methylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 88853616 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (2E,3Z)-N-(2,2-dimethoxyethyl)-2-ethylidene-5-methylhexa-3,5-dien-1-amine |
| SMILES | C=C(C)/C=C\C(=C/C)CNCC(OC)OC |
| InChI | InChI=1S/C13H23NO2/c1-6-12(8-7-11(2)3)9-14-10-13(15-4)16-5/h6-8,13-14H,2,9-10H2,1,3-5H3/b8-7-,12-6- |
| InChIKey | SJAWIEVMNWDISG-NHCUHXEMSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|