About 3-chloro-5-methoxy-4,6-dimethylpyridazine
3-chloro-5-methoxy-4,6-dimethylpyridazine (PubChem CID 88853959) has the molecular formula C7H9ClN2O
and a molecular weight of 172.61 g/mol. Its IUPAC name is 3-chloro-5-methoxy-4,6-dimethylpyridazine.
Molecular Properties
| Compound Name | 3-chloro-5-methoxy-4,6-dimethylpyridazine |
| PubChem CID | 88853959 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 3-chloro-5-methoxy-4,6-dimethylpyridazine |
| SMILES | COc1c(C)nnc(Cl)c1C |
| InChI | InChI=1S/C7H9ClN2O/c1-4-6(11-3)5(2)9-10-7(4)8/h1-3H3 |
| InChIKey | TVHDRSHQWAHMNB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-5-methoxy-4,6-dimethylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-methoxy-4,6-dimethylpyridazine?
The IUPAC name of 3-chloro-5-methoxy-4,6-dimethylpyridazine (CID 88853959) is 3-chloro-5-methoxy-4,6-dimethylpyridazine.
What is the SMILES notation for 3-chloro-5-methoxy-4,6-dimethylpyridazine?
The canonical SMILES for 3-chloro-5-methoxy-4,6-dimethylpyridazine is COc1c(C)nnc(Cl)c1C.
What is the InChIKey of 3-chloro-5-methoxy-4,6-dimethylpyridazine?
The InChIKey is TVHDRSHQWAHMNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O/c1-4-6(11-3)5(2)9-10-7(4)8/h1-3H3.
What are the key properties of 3-chloro-5-methoxy-4,6-dimethylpyridazine?
3-chloro-5-methoxy-4,6-dimethylpyridazine has a molecular weight of 172.61 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-methoxy-4,6-dimethylpyridazine is sourced from PubChem (CID 88853959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).