About 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline
4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline (PubChem CID 88854055) has the molecular formula C22H16ClFN2
and a molecular weight of 362.84 g/mol. Its IUPAC name is 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline.
Molecular Properties
| Compound Name | 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline |
| PubChem CID | 88854055 |
| Molecular Formula | C22H16ClFN2 |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline |
| SMILES | Cc1cc2nc(-c3ccc(-c4ccccc4)c(F)c3)nc(Cl)c2cc1C |
| InChI | InChI=1S/C22H16ClFN2/c1-13-10-18-20(11-14(13)2)25-22(26-21(18)23)16-8-9-17(19(24)12-16)15-6-4-3-5-7-15/h3-12H,1-2H3 |
| InChIKey | QYRCDWYATJKUBK-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline?
The IUPAC name of 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline (CID 88854055) is 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline.
What is the SMILES notation for 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline?
The canonical SMILES for 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline is Cc1cc2nc(-c3ccc(-c4ccccc4)c(F)c3)nc(Cl)c2cc1C.
What is the InChIKey of 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline?
The InChIKey is QYRCDWYATJKUBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClFN2/c1-13-10-18-20(11-14(13)2)25-22(26-21(18)23)16-8-9-17(19(24)12-16)15-6-4-3-5-7-15/h3-12H,1-2H3.
What are the key properties of 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline?
4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline has a molecular weight of 362.84 g/mol, XLogP of 6.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(3-fluoro-4-phenylphenyl)-6,7-dimethylquinazoline is sourced from PubChem (CID 88854055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).