C20H18Cl2N2O — CID 88854064
2,6-dichloro-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 88854064) has the molecular formula C20H18Cl2N2O and a molecular weight of 373.28 g/mol. Its IUPAC name is 2,6-dichloro-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2,6-dichloro-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 88854064 |
| Molecular Formula | C20H18Cl2N2O |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2,6-dichloro-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=CCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O/c1-2-11-25-15-6-3-13(4-7-15)20-19-16(9-10-24(20)22)17-12-14(21)5-8-18(17)23-19/h2-8,12,20,23H,1,9-11H2 |
| InChIKey | RYHWRIFYMMFNLP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|