C22H20N4O — CID 88854213
2-cyclopropyl-6,7-diphenyl-5,6,7,8-tetrahydropteridine-4-carbaldehyde (PubChem CID 88854213) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-cyclopropyl-6,7-diphenyl-5,6,7,8-tetrahydropteridine-4-carbaldehyde.
| Compound Name | 2-cyclopropyl-6,7-diphenyl-5,6,7,8-tetrahydropteridine-4-carbaldehyde |
|---|---|
| PubChem CID | 88854213 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-cyclopropyl-6,7-diphenyl-5,6,7,8-tetrahydropteridine-4-carbaldehyde |
| SMILES | O=Cc1nc(C2CC2)nc2c1NC(c1ccccc1)C(c1ccccc1)N2 |
| InChI | InChI=1S/C22H20N4O/c27-13-17-20-22(26-21(23-17)16-11-12-16)25-19(15-9-5-2-6-10-15)18(24-20)14-7-3-1-4-8-14/h1-10,13,16,18-19,24H,11-12H2,(H,23,25,26) |
| InChIKey | HNKUCPMHPNCQES-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|