C29H39ClN8O2 — CID 88854378
3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[2-(3-hydroxyphenyl)ethylamino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 88854378) has the molecular formula C29H39ClN8O2 and a molecular weight of 567.14 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[2-(3-hydroxyphenyl)ethylamino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[2-(3-hydroxyphenyl)ethylamino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88854378 |
| Molecular Formula | C29H39ClN8O2 |
| Molecular Weight | 567.14 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[4-[2-(3-hydroxyphenyl)ethylamino]pentyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC(CCCc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)NCCc1cccc(O)c1 |
| InChI | InChI=1S/C29H39ClN8O2/c1-19(34-17-15-22-9-5-10-23(39)18-22)6-4-8-21-13-11-20(12-14-21)7-2-3-16-35-29(33)38-28(40)24-26(31)37-27(32)25(30)36-24/h5,9-14,18-19,34,39H,2-4,6-8,15-17H2,1H3,(H4,31,32,37)(H3,33,35,38,40) |
| InChIKey | UTCMYEDEIDEXRE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 177.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|