C22H25BClN4O4PS — CID 88854431
CID 88854431 (PubChem CID 88854431) has the molecular formula C22H25BClN4O4PS and a molecular weight of 518.77 g/mol.
| Compound Name | CID 88854431 |
|---|---|
| PubChem CID | 88854431 |
| Molecular Formula | C22H25BClN4O4PS |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Nc2nc(Nc3ccc(P(C)(C)=O)cc3OC)ncc2Cl)c(S(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C22H25BClN4O4PS/c1-13(2)34(30,31)20-10-14(23)6-8-18(20)26-21-16(24)12-25-22(28-21)27-17-9-7-15(33(4,5)29)11-19(17)32-3/h6-13H,1-5H3,(H2,25,26,27,28) |
| InChIKey | YSAOUMIGXJYKJH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|