About 4-propan-2-ylheptane-2,6-diimine
4-propan-2-ylheptane-2,6-diimine (PubChem CID 88854693) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-propan-2-ylheptane-2,6-diimine.
Molecular Properties
| Compound Name | 4-propan-2-ylheptane-2,6-diimine |
| PubChem CID | 88854693 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 4-propan-2-ylheptane-2,6-diimine |
| SMILES | [H]/N=C(/C)CC(C/C(C)=N\[H])C(C)C |
| InChI | InChI=1S/C10H20N2/c1-7(2)10(5-8(3)11)6-9(4)12/h7,10-12H,5-6H2,1-4H3/b11-8-,12-9- |
| InChIKey | KEWBJKHAWSXKFC-QAHSQZNUSA-N |
| XLogP | 3.12 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylheptane-2,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylheptane-2,6-diimine?
The IUPAC name of 4-propan-2-ylheptane-2,6-diimine (CID 88854693) is 4-propan-2-ylheptane-2,6-diimine.
What is the SMILES notation for 4-propan-2-ylheptane-2,6-diimine?
The canonical SMILES for 4-propan-2-ylheptane-2,6-diimine is [H]/N=C(/C)CC(C/C(C)=N\[H])C(C)C.
What is the InChIKey of 4-propan-2-ylheptane-2,6-diimine?
The InChIKey is KEWBJKHAWSXKFC-QAHSQZNUSA-N. The full InChI is InChI=1S/C10H20N2/c1-7(2)10(5-8(3)11)6-9(4)12/h7,10-12H,5-6H2,1-4H3/b11-8-,12-9-.
What are the key properties of 4-propan-2-ylheptane-2,6-diimine?
4-propan-2-ylheptane-2,6-diimine has a molecular weight of 168.28 g/mol, XLogP of 3.12, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylheptane-2,6-diimine is sourced from PubChem (CID 88854693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).