C9H15F4NO2S — CID 88854828
4-methyl-1-(1,1,2,2-tetrafluoropropylsulfonyl)piperidine (PubChem CID 88854828) has the molecular formula C9H15F4NO2S and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-methyl-1-(1,1,2,2-tetrafluoropropylsulfonyl)piperidine.
| Compound Name | 4-methyl-1-(1,1,2,2-tetrafluoropropylsulfonyl)piperidine |
|---|---|
| PubChem CID | 88854828 |
| Molecular Formula | C9H15F4NO2S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-methyl-1-(1,1,2,2-tetrafluoropropylsulfonyl)piperidine |
| SMILES | CC1CCN(S(=O)(=O)C(F)(F)C(C)(F)F)CC1 |
| InChI | InChI=1S/C9H15F4NO2S/c1-7-3-5-14(6-4-7)17(15,16)9(12,13)8(2,10)11/h7H,3-6H2,1-2H3 |
| InChIKey | HPNBQZQMRGSTPN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|