C22H17F2N5O — CID 88855024
N-[(3,4-difluorophenyl)methyl]-5-isocyano-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridin-3-amine (PubChem CID 88855024) has the molecular formula C22H17F2N5O and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-5-isocyano-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridin-3-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-5-isocyano-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 88855024 |
| Molecular Formula | C22H17F2N5O |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-5-isocyano-1-[(4-methoxyphenyl)methyl]pyrazolo[5,4-b]pyridin-3-amine |
| SMILES | [C-]#[N+]c1cnc2c(c1)c(NCc1ccc(F)c(F)c1)nn2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H17F2N5O/c1-25-16-10-18-21(26-11-15-5-8-19(23)20(24)9-15)28-29(22(18)27-12-16)13-14-3-6-17(30-2)7-4-14/h3-10,12H,11,13H2,2H3,(H,26,28) |
| InChIKey | ZVQNJGMAZYHWHG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|