About [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate
[2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate (PubChem CID 88855035) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate.
Molecular Properties
| Compound Name | [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate |
| PubChem CID | 88855035 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate |
| SMILES | C=CC(=O)NCC(C)(C)COC(C)=O |
| InChI | InChI=1S/C10H17NO3/c1-5-9(13)11-6-10(3,4)7-14-8(2)12/h5H,1,6-7H2,2-4H3,(H,11,13) |
| InChIKey | KGJOKSZZZKFDJQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate?
The IUPAC name of [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate (CID 88855035) is [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate.
What is the SMILES notation for [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate?
The canonical SMILES for [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate is C=CC(=O)NCC(C)(C)COC(C)=O.
What is the InChIKey of [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate?
The InChIKey is KGJOKSZZZKFDJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-5-9(13)11-6-10(3,4)7-14-8(2)12/h5H,1,6-7H2,2-4H3,(H,11,13).
What are the key properties of [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate?
[2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate has a molecular weight of 199.25 g/mol, XLogP of 0.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-3-(prop-2-enoylamino)propyl] acetate is sourced from PubChem (CID 88855035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).