C64H90F2N2O2S5 — CID 88855328
4,7-bis[8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-11-yl]-5,6-difluoro-2,1,3-benzothiadiazole (PubChem CID 88855328) has the molecular formula C64H90F2N2O2S5 and a molecular weight of 1117.77 g/mol. Its IUPAC name is 4,7-bis[8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-11-yl]-5,6-difluoro-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-11-yl]-5,6-difluoro-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 88855328 |
| Molecular Formula | C64H90F2N2O2S5 |
| Molecular Weight | 1117.77 g/mol |
| Exact Mass | 1116.56 |
| IUPAC Name | 4,7-bis[8,8-bis(3,7-dimethyloctyl)-7-oxa-3,12-dithiatricyclo[7.3.0.02,6]dodeca-1(9),2(6),4,10-tetraen-11-yl]-5,6-difluoro-2,1,3-benzothiadiazole |
| SMILES | CC(C)CCCC(C)CCC1(CCC(C)CCCC(C)C)Oc2ccsc2-c2sc(-c3c(F)c(F)c(-c4cc5c(s4)-c4sccc4OC5(CCC(C)CCCC(C)C)CCC(C)CCCC(C)C)c4nsnc34)cc21 |
| InChI | InChI=1S/C64H90F2N2O2S5/c1-39(2)17-13-21-43(9)25-31-63(32-26-44(10)22-14-18-40(3)4)47-37-51(73-59(47)61-49(69-63)29-35-71-61)53-55(65)56(66)54(58-57(53)67-75-68-58)52-38-48-60(74-52)62-50(30-36-72-62)70-64(48,33-27-45(11)23-15-19-41(5)6)34-28-46(12)24-16-20-42(7)8/h29-30,35-46H,13-28,31-34H2,1-12H3 |
| InChIKey | CBNWBVBGLYKHQH-UHFFFAOYSA-N |
| XLogP | 23.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1117.77 |
| LogP ≤ 5 | 23.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |