C27H31FN3O2+ — CID 88855402
4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-1-propan-2-ylpiperazin-1-ium (PubChem CID 88855402) has the molecular formula C27H31FN3O2+ and a molecular weight of 448.56 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-1-propan-2-ylpiperazin-1-ium.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-1-propan-2-ylpiperazin-1-ium |
|---|---|
| PubChem CID | 88855402 |
| Molecular Formula | C27H31FN3O2+ |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-[[5-(4-fluorophenyl)-3-pyridinyl]methyl]-1-propan-2-ylpiperazin-1-ium |
| SMILES | CC(C)[N+]1(Cc2cncc(-c3ccc(F)cc3)c2)CCN(c2cccc3c2OCCO3)CC1 |
| InChI | InChI=1S/C27H31FN3O2/c1-20(2)31(19-21-16-23(18-29-17-21)22-6-8-24(28)9-7-22)12-10-30(11-13-31)25-4-3-5-26-27(25)33-15-14-32-26/h3-9,16-18,20H,10-15,19H2,1-2H3/q+1 |
| InChIKey | VGUAWLHFKWGEAN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|