About methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate
methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate (PubChem CID 88855425) has the molecular formula C28H26N4O4
and a molecular weight of 482.54 g/mol. Its IUPAC name is methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate |
| PubChem CID | 88855425 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)C1(C(=[N+]=[N-])C2=O)c2ccc(N(C)C)cc2Oc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C28H26N4O4/c1-31(2)17-7-10-20-23(14-17)36-24-15-18(32(3)4)8-11-21(24)28(20)22-12-16(13-25(33)35-5)6-9-19(22)26(34)27(28)30-29/h6-12,14-15H,13H2,1-5H3 |
| InChIKey | LDWZLKCYHARFHB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate?
The IUPAC name of methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate (CID 88855425) is methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate.
What is the SMILES notation for methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate?
The canonical SMILES for methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate is COC(=O)Cc1ccc2c(c1)C1(C(=[N+]=[N-])C2=O)c2ccc(N(C)C)cc2Oc2cc(N(C)C)ccc21.
What is the InChIKey of methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate?
The InChIKey is LDWZLKCYHARFHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N4O4/c1-31(2)17-7-10-20-23(14-17)36-24-15-18(32(3)4)8-11-21(24)28(20)22-12-16(13-25(33)35-5)6-9-19(22)26(34)27(28)30-29/h6-12,14-15H,13H2,1-5H3.
What are the key properties of methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate?
methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate has a molecular weight of 482.54 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-diazo-3',6'-bis(dimethylamino)-1-oxospiro[indene-3,9'-xanthene]-5-yl]acetate is sourced from PubChem (CID 88855425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).