C36H16F10N4 — CID 88855520
10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene (PubChem CID 88855520) has the molecular formula C36H16F10N4 and a molecular weight of 694.53 g/mol. Its IUPAC name is 10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene.
| Compound Name | 10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 88855520 |
| Molecular Formula | C36H16F10N4 |
| Molecular Weight | 694.53 g/mol |
| Exact Mass | 694.12 |
| IUPAC Name | 10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14,16,18-nonaene |
| SMILES | CC1(C)c2ccccc2-n2c3ccccc3c3cc(-c4nc(-c5c(F)c(F)c(F)c(F)c5F)nc(-c5c(F)c(F)c(F)c(F)c5F)n4)cc1c32 |
| InChI | InChI=1S/C36H16F10N4/c1-36(2)16-8-4-6-10-19(16)50-18-9-5-3-7-14(18)15-11-13(12-17(36)32(15)50)33-47-34(20-22(37)26(41)30(45)27(42)23(20)38)49-35(48-33)21-24(39)28(43)31(46)29(44)25(21)40/h3-12H,1-2H3 |
| InChIKey | WBIMQTZCWGVXDR-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.53 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|