C36H20F6N4 — CID 88855554
5-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-13,13-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene (PubChem CID 88855554) has the molecular formula C36H20F6N4 and a molecular weight of 622.57 g/mol. Its IUPAC name is 5-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-13,13-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene.
| Compound Name | 5-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-13,13-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 88855554 |
| Molecular Formula | C36H20F6N4 |
| Molecular Weight | 622.57 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | 5-[4,6-bis(trifluoromethyl)-1,3,5-triazin-2-yl]-13,13-diphenyl-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
| SMILES | FC(F)(F)c1nc(-c2ccc3c(c2)c2cccc4c2n3-c2ccccc2C4(c2ccccc2)c2ccccc2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C36H20F6N4/c37-35(38,39)32-43-31(44-33(45-32)36(40,41)42)21-18-19-28-25(20-21)24-14-9-16-27-30(24)46(28)29-17-8-7-15-26(29)34(27,22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-20H |
| InChIKey | NXFISDZNIRQQFM-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.57 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |