About 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide
3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide (PubChem CID 88855719) has the molecular formula C9H13ClN4O
and a molecular weight of 228.68 g/mol. Its IUPAC name is 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide.
Molecular Properties
| Compound Name | 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide |
| PubChem CID | 88855719 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide |
| SMILES | CNN(C)C(=O)c1nc(Cl)cc(C)c1N |
| InChI | InChI=1S/C9H13ClN4O/c1-5-4-6(10)13-8(7(5)11)9(15)14(3)12-2/h4,12H,11H2,1-3H3 |
| InChIKey | BUZVXXBZBBORJZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide?
The IUPAC name of 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide (CID 88855719) is 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide.
What is the SMILES notation for 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide?
The canonical SMILES for 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide is CNN(C)C(=O)c1nc(Cl)cc(C)c1N.
What is the InChIKey of 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide?
The InChIKey is BUZVXXBZBBORJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN4O/c1-5-4-6(10)13-8(7(5)11)9(15)14(3)12-2/h4,12H,11H2,1-3H3.
What are the key properties of 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide?
3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide has a molecular weight of 228.68 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-chloro-N,N',4-trimethylpyridine-2-carbohydrazide is sourced from PubChem (CID 88855719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).