2-ethoxy-5,5,5-trifluoropent-2-enoic acid

C7H9F3O3 — CID 88855724

IUPAC2-ethoxy-5,5,5-trifluoropent-2-enoic acid
SMILESCCOC(=CCC(F)(F)F)C(=O)O
InChIInChI=1S/C7H9F3O3/c1-2-13-5(6(11)12)3-4-7(8,9)10/h3H,2,4H2,1H3,(H,11,12)
InChIKeyBALZFVUYBJBEQU-UHFFFAOYSA-N
MW198.14 g/mol
LogP1.94
Rot. Bonds4

About 2-ethoxy-5,5,5-trifluoropent-2-enoic acid

2-ethoxy-5,5,5-trifluoropent-2-enoic acid (PubChem CID 88855724) has the molecular formula C7H9F3O3 and a molecular weight of 198.14 g/mol. Its IUPAC name is 2-ethoxy-5,5,5-trifluoropent-2-enoic acid.

Molecular Properties

Compound Name2-ethoxy-5,5,5-trifluoropent-2-enoic acid
PubChem CID88855724
Molecular FormulaC7H9F3O3
Molecular Weight198.14 g/mol
Exact Mass198.05
IUPAC Name2-ethoxy-5,5,5-trifluoropent-2-enoic acid
SMILESCCOC(=CCC(F)(F)F)C(=O)O
InChIInChI=1S/C7H9F3O3/c1-2-13-5(6(11)12)3-4-7(8,9)10/h3H,2,4H2,1H3,(H,11,12)
InChIKeyBALZFVUYBJBEQU-UHFFFAOYSA-N
XLogP1.94
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.14
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethoxy-5,5,5-trifluoropent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-5,5,5-trifluoropent-2-enoic acid?
The IUPAC name of 2-ethoxy-5,5,5-trifluoropent-2-enoic acid (CID 88855724) is 2-ethoxy-5,5,5-trifluoropent-2-enoic acid.
What is the SMILES notation for 2-ethoxy-5,5,5-trifluoropent-2-enoic acid?
The canonical SMILES for 2-ethoxy-5,5,5-trifluoropent-2-enoic acid is CCOC(=CCC(F)(F)F)C(=O)O.
What is the InChIKey of 2-ethoxy-5,5,5-trifluoropent-2-enoic acid?
The InChIKey is BALZFVUYBJBEQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3O3/c1-2-13-5(6(11)12)3-4-7(8,9)10/h3H,2,4H2,1H3,(H,11,12).
What are the key properties of 2-ethoxy-5,5,5-trifluoropent-2-enoic acid?
2-ethoxy-5,5,5-trifluoropent-2-enoic acid has a molecular weight of 198.14 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5,5,5-trifluoropent-2-enoic acid is sourced from PubChem (CID 88855724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).