C14H21NO7S — CID 88855994
5-(2,5-dioxopyrrol-1-yl)-1-methoxy-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid (PubChem CID 88855994) has the molecular formula C14H21NO7S and a molecular weight of 347.39 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)-1-methoxy-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid.
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)-1-methoxy-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid |
|---|---|
| PubChem CID | 88855994 |
| Molecular Formula | C14H21NO7S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)-1-methoxy-3,3,5-trimethyl-1-oxohexane-2-sulfonic acid |
| SMILES | COC(=O)C(C(C)(C)CC(C)(C)N1C(=O)C=CC1=O)S(=O)(=O)O |
| InChI | InChI=1S/C14H21NO7S/c1-13(2,11(12(18)22-5)23(19,20)21)8-14(3,4)15-9(16)6-7-10(15)17/h6-7,11H,8H2,1-5H3,(H,19,20,21) |
| InChIKey | KYFSYIGUSVWZCD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|