About (2Z,4E)-6-methylhepta-2,4-dien-4-ol
(2Z,4E)-6-methylhepta-2,4-dien-4-ol (PubChem CID 88856291) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is (2Z,4E)-6-methylhepta-2,4-dien-4-ol.
Molecular Properties
| Compound Name | (2Z,4E)-6-methylhepta-2,4-dien-4-ol |
| PubChem CID | 88856291 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2Z,4E)-6-methylhepta-2,4-dien-4-ol |
| SMILES | C/C=C\C(O)=C/C(C)C |
| InChI | InChI=1S/C8H14O/c1-4-5-8(9)6-7(2)3/h4-7,9H,1-3H3/b5-4-,8-6+ |
| InChIKey | GGJACIVDDYMEBM-GSGSLZOQSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-6-methylhepta-2,4-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-6-methylhepta-2,4-dien-4-ol?
The IUPAC name of (2Z,4E)-6-methylhepta-2,4-dien-4-ol (CID 88856291) is (2Z,4E)-6-methylhepta-2,4-dien-4-ol.
What is the SMILES notation for (2Z,4E)-6-methylhepta-2,4-dien-4-ol?
The canonical SMILES for (2Z,4E)-6-methylhepta-2,4-dien-4-ol is C/C=C\C(O)=C/C(C)C.
What is the InChIKey of (2Z,4E)-6-methylhepta-2,4-dien-4-ol?
The InChIKey is GGJACIVDDYMEBM-GSGSLZOQSA-N. The full InChI is InChI=1S/C8H14O/c1-4-5-8(9)6-7(2)3/h4-7,9H,1-3H3/b5-4-,8-6+.
What are the key properties of (2Z,4E)-6-methylhepta-2,4-dien-4-ol?
(2Z,4E)-6-methylhepta-2,4-dien-4-ol has a molecular weight of 126.20 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-6-methylhepta-2,4-dien-4-ol is sourced from PubChem (CID 88856291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).