C22H21NO6 — CID 88856621
tert-butyl 2-[(4-hydroxy-2-oxo-8-phenylchromene-3-carbonyl)amino]acetate (PubChem CID 88856621) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is tert-butyl 2-[(4-hydroxy-2-oxo-8-phenylchromene-3-carbonyl)amino]acetate.
| Compound Name | tert-butyl 2-[(4-hydroxy-2-oxo-8-phenylchromene-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 88856621 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | tert-butyl 2-[(4-hydroxy-2-oxo-8-phenylchromene-3-carbonyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)c1c(O)c2cccc(-c3ccccc3)c2oc1=O |
| InChI | InChI=1S/C22H21NO6/c1-22(2,3)29-16(24)12-23-20(26)17-18(25)15-11-7-10-14(19(15)28-21(17)27)13-8-5-4-6-9-13/h4-11,25H,12H2,1-3H3,(H,23,26) |
| InChIKey | HUVMCJBFMSYSJB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|