About 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile
2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile (PubChem CID 88856819) has the molecular formula C20H24N4
and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile.
Molecular Properties
| Compound Name | 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile |
| PubChem CID | 88856819 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile |
| SMILES | CCCCN(CCCC)c1ccc(C(C#N)=C(C#N)C#N)c(C)c1 |
| InChI | InChI=1S/C20H24N4/c1-4-6-10-24(11-7-5-2)18-8-9-19(16(3)12-18)20(15-23)17(13-21)14-22/h8-9,12H,4-7,10-11H2,1-3H3 |
| InChIKey | BCSPZQULMYFSEY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile?
The IUPAC name of 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile (CID 88856819) is 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile.
What is the SMILES notation for 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile?
The canonical SMILES for 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile is CCCCN(CCCC)c1ccc(C(C#N)=C(C#N)C#N)c(C)c1.
What is the InChIKey of 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile?
The InChIKey is BCSPZQULMYFSEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4/c1-4-6-10-24(11-7-5-2)18-8-9-19(16(3)12-18)20(15-23)17(13-21)14-22/h8-9,12H,4-7,10-11H2,1-3H3.
What are the key properties of 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile?
2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile has a molecular weight of 320.44 g/mol, XLogP of 4.73, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dibutylamino)-2-methylphenyl]ethene-1,1,2-tricarbonitrile is sourced from PubChem (CID 88856819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).