About (Z)-2-isocyano-4,4-dimethylpent-2-ene
(Z)-2-isocyano-4,4-dimethylpent-2-ene (PubChem CID 88856835) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is (Z)-2-isocyano-4,4-dimethylpent-2-ene.
Molecular Properties
| Compound Name | (Z)-2-isocyano-4,4-dimethylpent-2-ene |
| PubChem CID | 88856835 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (Z)-2-isocyano-4,4-dimethylpent-2-ene |
| SMILES | [C-]#[N+]/C(C)=C\C(C)(C)C |
| InChI | InChI=1S/C8H13N/c1-7(9-5)6-8(2,3)4/h6H,1-4H3/b7-6- |
| InChIKey | GKLYLHUYYXNXGU-SREVYHEPSA-N |
| XLogP | 2.86 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-isocyano-4,4-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-isocyano-4,4-dimethylpent-2-ene?
The IUPAC name of (Z)-2-isocyano-4,4-dimethylpent-2-ene (CID 88856835) is (Z)-2-isocyano-4,4-dimethylpent-2-ene.
What is the SMILES notation for (Z)-2-isocyano-4,4-dimethylpent-2-ene?
The canonical SMILES for (Z)-2-isocyano-4,4-dimethylpent-2-ene is [C-]#[N+]/C(C)=C\C(C)(C)C.
What is the InChIKey of (Z)-2-isocyano-4,4-dimethylpent-2-ene?
The InChIKey is GKLYLHUYYXNXGU-SREVYHEPSA-N. The full InChI is InChI=1S/C8H13N/c1-7(9-5)6-8(2,3)4/h6H,1-4H3/b7-6-.
What are the key properties of (Z)-2-isocyano-4,4-dimethylpent-2-ene?
(Z)-2-isocyano-4,4-dimethylpent-2-ene has a molecular weight of 123.20 g/mol, XLogP of 2.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-isocyano-4,4-dimethylpent-2-ene is sourced from PubChem (CID 88856835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).