C12H16F8N2O4 — CID 88856956
2-[2-[1,1-difluoro-2-oxo-2-(propylamino)ethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoro-N-propylacetamide (PubChem CID 88856956) has the molecular formula C12H16F8N2O4 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2-[2-[1,1-difluoro-2-oxo-2-(propylamino)ethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoro-N-propylacetamide.
| Compound Name | 2-[2-[1,1-difluoro-2-oxo-2-(propylamino)ethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoro-N-propylacetamide |
|---|---|
| PubChem CID | 88856956 |
| Molecular Formula | C12H16F8N2O4 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[2-[1,1-difluoro-2-oxo-2-(propylamino)ethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoro-N-propylacetamide |
| SMILES | CCCNC(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(=O)NCCC |
| InChI | InChI=1S/C12H16F8N2O4/c1-3-5-21-7(23)9(13,14)25-11(17,18)12(19,20)26-10(15,16)8(24)22-6-4-2/h3-6H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | AFPDGTLAWQYZGU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|