C11H18F6N2O4 — CID 88856967
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,2-difluoro-2-(1,1,2,2-tetrafluoropropoxy)acetamide (PubChem CID 88856967) has the molecular formula C11H18F6N2O4 and a molecular weight of 356.26 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,2-difluoro-2-(1,1,2,2-tetrafluoropropoxy)acetamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,2-difluoro-2-(1,1,2,2-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 88856967 |
| Molecular Formula | C11H18F6N2O4 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2,2-difluoro-2-(1,1,2,2-tetrafluoropropoxy)acetamide |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)C(=O)NCCOCCOCCN |
| InChI | InChI=1S/C11H18F6N2O4/c1-9(12,13)11(16,17)23-10(14,15)8(20)19-3-5-22-7-6-21-4-2-18/h2-7,18H2,1H3,(H,19,20) |
| InChIKey | JUFAQEPWFQNDRL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|