C10H15F6NO4 — CID 88856968
2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]-2-(1,1,2,2-tetrafluoropropoxy)acetamide (PubChem CID 88856968) has the molecular formula C10H15F6NO4 and a molecular weight of 327.22 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]-2-(1,1,2,2-tetrafluoropropoxy)acetamide.
| Compound Name | 2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]-2-(1,1,2,2-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 88856968 |
| Molecular Formula | C10H15F6NO4 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2,2-difluoro-N-[2-(2-methoxyethoxy)ethyl]-2-(1,1,2,2-tetrafluoropropoxy)acetamide |
| SMILES | COCCOCCNC(=O)C(F)(F)OC(F)(F)C(C)(F)F |
| InChI | InChI=1S/C10H15F6NO4/c1-8(11,12)10(15,16)21-9(13,14)7(18)17-3-4-20-6-5-19-2/h3-6H2,1-2H3,(H,17,18) |
| InChIKey | SDYYFZMTJZPRSI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|