C18H13FIN3OS2 — CID 88857125
4-[4,4-dimethyl-5-oxo-2-sulfanylidene-3-(4-sulfanylphenyl)imidazolidin-1-yl]-3-fluoro-2-iodobenzonitrile (PubChem CID 88857125) has the molecular formula C18H13FIN3OS2 and a molecular weight of 497.36 g/mol. Its IUPAC name is 4-[4,4-dimethyl-5-oxo-2-sulfanylidene-3-(4-sulfanylphenyl)imidazolidin-1-yl]-3-fluoro-2-iodobenzonitrile.
| Compound Name | 4-[4,4-dimethyl-5-oxo-2-sulfanylidene-3-(4-sulfanylphenyl)imidazolidin-1-yl]-3-fluoro-2-iodobenzonitrile |
|---|---|
| PubChem CID | 88857125 |
| Molecular Formula | C18H13FIN3OS2 |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | 4-[4,4-dimethyl-5-oxo-2-sulfanylidene-3-(4-sulfanylphenyl)imidazolidin-1-yl]-3-fluoro-2-iodobenzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(I)c2F)C(=S)N1c1ccc(S)cc1 |
| InChI | InChI=1S/C18H13FIN3OS2/c1-18(2)16(24)22(13-8-3-10(9-21)15(20)14(13)19)17(26)23(18)11-4-6-12(25)7-5-11/h3-8,25H,1-2H3 |
| InChIKey | QHTBRALRDYITDX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 47.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|