C31H44ClN3O6 — CID 88857344
[(1Z,6E)-7-chloro-1-[[3,3-dimethyl-2-[[(2E,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 88857344) has the molecular formula C31H44ClN3O6 and a molecular weight of 590.16 g/mol. Its IUPAC name is [(1Z,6E)-7-chloro-1-[[3,3-dimethyl-2-[[(2E,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(1Z,6E)-7-chloro-1-[[3,3-dimethyl-2-[[(2E,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 88857344 |
| Molecular Formula | C31H44ClN3O6 |
| Molecular Weight | 590.16 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | [(1Z,6E)-7-chloro-1-[[3,3-dimethyl-2-[[(2E,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | CC1=CCC(C(C)/C=C(C)/C=C/C=C/C(=O)NC(C(=O)N/C=C\CC(C/C=C(\C)Cl)OC(N)=O)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C31H44ClN3O6/c1-20(19-22(3)25-17-14-21(2)29(38)41-25)11-8-9-13-26(36)35-27(31(5,6)7)28(37)34-18-10-12-24(40-30(33)39)16-15-23(4)32/h8-11,13-15,18-19,22,24-25,27H,12,16-17H2,1-7H3,(H2,33,39)(H,34,37)(H,35,36)/b11-8+,13-9+,18-10-,20-19+,23-15+ |
| InChIKey | DLDAREFZYIQOFG-JMXNUGANSA-N |
| XLogP | 5.49 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.16 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|