C31H45N3O6 — CID 88857345
[(1Z,6Z)-1-[[3,3-dimethyl-2-[[(2Z,4Z,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 88857345) has the molecular formula C31H45N3O6 and a molecular weight of 555.72 g/mol. Its IUPAC name is [(1Z,6Z)-1-[[3,3-dimethyl-2-[[(2Z,4Z,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(1Z,6Z)-1-[[3,3-dimethyl-2-[[(2Z,4Z,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 88857345 |
| Molecular Formula | C31H45N3O6 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.33 |
| IUPAC Name | [(1Z,6Z)-1-[[3,3-dimethyl-2-[[(2Z,4Z,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | C/C=C\CC(C/C=C\NC(=O)C(NC(=O)/C=C\C=C/C(C)=C/C(C)C1CC=C(C)C(=O)O1)C(C)(C)C)OC(N)=O |
| InChI | InChI=1S/C31H45N3O6/c1-8-9-14-24(39-30(32)38)15-12-19-33-28(36)27(31(5,6)7)34-26(35)16-11-10-13-21(2)20-23(4)25-18-17-22(3)29(37)40-25/h8-13,16-17,19-20,23-25,27H,14-15,18H2,1-7H3,(H2,32,38)(H,33,36)(H,34,35)/b9-8-,13-10-,16-11-,19-12-,21-20+ |
| InChIKey | QCKDKTVLHWDIGX-PXRLQDPJSA-N |
| XLogP | 4.92 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|