C30H42ClN3O6 — CID 88857346
[(1Z,6E)-7-chloro-1-[[3-methyl-2-[[(2Z,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 88857346) has the molecular formula C30H42ClN3O6 and a molecular weight of 576.13 g/mol. Its IUPAC name is [(1Z,6E)-7-chloro-1-[[3-methyl-2-[[(2Z,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(1Z,6E)-7-chloro-1-[[3-methyl-2-[[(2Z,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 88857346 |
| Molecular Formula | C30H42ClN3O6 |
| Molecular Weight | 576.13 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | [(1Z,6E)-7-chloro-1-[[3-methyl-2-[[(2Z,4E,6E)-6-methyl-8-(5-methyl-6-oxo-2,3-dihydropyran-2-yl)nona-2,4,6-trienoyl]amino]butanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | CC1=CCC(C(C)/C=C(C)/C=C/C=C\C(=O)NC(C(=O)N/C=C\CC(C/C=C(\C)Cl)OC(N)=O)C(C)C)OC1=O |
| InChI | InChI=1S/C30H42ClN3O6/c1-19(2)27(28(36)33-17-9-11-24(39-30(32)38)15-14-23(6)31)34-26(35)12-8-7-10-20(3)18-22(5)25-16-13-21(4)29(37)40-25/h7-10,12-14,17-19,22,24-25,27H,11,15-16H2,1-6H3,(H2,32,38)(H,33,36)(H,34,35)/b10-7+,12-8-,17-9-,20-18+,23-14+ |
| InChIKey | DHJRTGGYGCHAMO-NKRFAATFSA-N |
| XLogP | 5.10 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.13 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|