About N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide (PubChem CID 88857523) has the molecular formula C10H21NO4
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide |
| PubChem CID | 88857523 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)NC(CO)(CO)CO |
| InChI | InChI=1S/C10H21NO4/c1-4-9(2,3)8(15)11-10(5-12,6-13)7-14/h12-14H,4-7H2,1-3H3,(H,11,15) |
| InChIKey | XHJDYEAVWQXGBK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide?
The IUPAC name of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide (CID 88857523) is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide.
What is the SMILES notation for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide?
The canonical SMILES for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide is CCC(C)(C)C(=O)NC(CO)(CO)CO.
What is the InChIKey of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide?
The InChIKey is XHJDYEAVWQXGBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4/c1-4-9(2,3)8(15)11-10(5-12,6-13)7-14/h12-14H,4-7H2,1-3H3,(H,11,15).
What are the key properties of N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide?
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide has a molecular weight of 219.28 g/mol, XLogP of -0.75, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-2,2-dimethylbutanamide is sourced from PubChem (CID 88857523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).