C23H35ClN2O4 — CID 88857552
(2,4,6-trimethylcyclohexyl) 2-(5-chloropentanoylamino)-5-formyl-4-propan-2-yl-1H-pyrrole-3-carboxylate (PubChem CID 88857552) has the molecular formula C23H35ClN2O4 and a molecular weight of 439.00 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-(5-chloropentanoylamino)-5-formyl-4-propan-2-yl-1H-pyrrole-3-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-(5-chloropentanoylamino)-5-formyl-4-propan-2-yl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 88857552 |
| Molecular Formula | C23H35ClN2O4 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-(5-chloropentanoylamino)-5-formyl-4-propan-2-yl-1H-pyrrole-3-carboxylate |
| SMILES | CC1CC(C)C(OC(=O)c2c(NC(=O)CCCCCl)[nH]c(C=O)c2C(C)C)C(C)C1 |
| InChI | InChI=1S/C23H35ClN2O4/c1-13(2)19-17(12-27)25-22(26-18(28)8-6-7-9-24)20(19)23(29)30-21-15(4)10-14(3)11-16(21)5/h12-16,21,25H,6-11H2,1-5H3,(H,26,28) |
| InChIKey | PWOIUSKKCDUFNS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|