About (2-methoxy-1,3-thiazol-4-yl) formate
(2-methoxy-1,3-thiazol-4-yl) formate (PubChem CID 88857718) has the molecular formula C5H5NO3S
and a molecular weight of 159.17 g/mol. Its IUPAC name is (2-methoxy-1,3-thiazol-4-yl) formate.
Molecular Properties
| Compound Name | (2-methoxy-1,3-thiazol-4-yl) formate |
| PubChem CID | 88857718 |
| Molecular Formula | C5H5NO3S |
| Molecular Weight | 159.17 g/mol |
| Exact Mass | 159.00 |
| IUPAC Name | (2-methoxy-1,3-thiazol-4-yl) formate |
| SMILES | COc1nc(OC=O)cs1 |
| InChI | InChI=1S/C5H5NO3S/c1-8-5-6-4(2-10-5)9-3-7/h2-3H,1H3 |
| InChIKey | VQWDUEQWIXVAMI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-1,3-thiazol-4-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-1,3-thiazol-4-yl) formate?
The IUPAC name of (2-methoxy-1,3-thiazol-4-yl) formate (CID 88857718) is (2-methoxy-1,3-thiazol-4-yl) formate.
What is the SMILES notation for (2-methoxy-1,3-thiazol-4-yl) formate?
The canonical SMILES for (2-methoxy-1,3-thiazol-4-yl) formate is COc1nc(OC=O)cs1.
What is the InChIKey of (2-methoxy-1,3-thiazol-4-yl) formate?
The InChIKey is VQWDUEQWIXVAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S/c1-8-5-6-4(2-10-5)9-3-7/h2-3H,1H3.
What are the key properties of (2-methoxy-1,3-thiazol-4-yl) formate?
(2-methoxy-1,3-thiazol-4-yl) formate has a molecular weight of 159.17 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-1,3-thiazol-4-yl) formate is sourced from PubChem (CID 88857718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).