About (2-bromo-1,3-thiazol-4-yl) formate
(2-bromo-1,3-thiazol-4-yl) formate (PubChem CID 88857719) has the molecular formula C4H2BrNO2S
and a molecular weight of 208.04 g/mol. Its IUPAC name is (2-bromo-1,3-thiazol-4-yl) formate.
Molecular Properties
| Compound Name | (2-bromo-1,3-thiazol-4-yl) formate |
| PubChem CID | 88857719 |
| Molecular Formula | C4H2BrNO2S |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.90 |
| IUPAC Name | (2-bromo-1,3-thiazol-4-yl) formate |
| SMILES | O=COc1csc(Br)n1 |
| InChI | InChI=1S/C4H2BrNO2S/c5-4-6-3(1-9-4)8-2-7/h1-2H |
| InChIKey | DEDMSMVMKWVFJZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-1,3-thiazol-4-yl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-1,3-thiazol-4-yl) formate?
The IUPAC name of (2-bromo-1,3-thiazol-4-yl) formate (CID 88857719) is (2-bromo-1,3-thiazol-4-yl) formate.
What is the SMILES notation for (2-bromo-1,3-thiazol-4-yl) formate?
The canonical SMILES for (2-bromo-1,3-thiazol-4-yl) formate is O=COc1csc(Br)n1.
What is the InChIKey of (2-bromo-1,3-thiazol-4-yl) formate?
The InChIKey is DEDMSMVMKWVFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrNO2S/c5-4-6-3(1-9-4)8-2-7/h1-2H.
What are the key properties of (2-bromo-1,3-thiazol-4-yl) formate?
(2-bromo-1,3-thiazol-4-yl) formate has a molecular weight of 208.04 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-1,3-thiazol-4-yl) formate is sourced from PubChem (CID 88857719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).