C10H4F10O2 — CID 88857732
1-[2,2-difluoro-2-(fluoromethoxy)ethoxy]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene (PubChem CID 88857732) has the molecular formula C10H4F10O2 and a molecular weight of 346.12 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-(fluoromethoxy)ethoxy]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene.
| Compound Name | 1-[2,2-difluoro-2-(fluoromethoxy)ethoxy]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 88857732 |
| Molecular Formula | C10H4F10O2 |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 1-[2,2-difluoro-2-(fluoromethoxy)ethoxy]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene |
| SMILES | FCOC(F)(F)COc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10H4F10O2/c11-2-22-9(16,17)1-21-8-6(14)4(12)3(10(18,19)20)5(13)7(8)15/h1-2H2 |
| InChIKey | YMJKQGUODHTOGU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|