C14H20F10O — CID 88857735
3-[(2-ethyl-1,1,2,3,3-pentafluoropentoxy)-difluoromethyl]-3,4,4-trifluorohexane (PubChem CID 88857735) has the molecular formula C14H20F10O and a molecular weight of 394.29 g/mol. Its IUPAC name is 3-[(2-ethyl-1,1,2,3,3-pentafluoropentoxy)-difluoromethyl]-3,4,4-trifluorohexane.
| Compound Name | 3-[(2-ethyl-1,1,2,3,3-pentafluoropentoxy)-difluoromethyl]-3,4,4-trifluorohexane |
|---|---|
| PubChem CID | 88857735 |
| Molecular Formula | C14H20F10O |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-[(2-ethyl-1,1,2,3,3-pentafluoropentoxy)-difluoromethyl]-3,4,4-trifluorohexane |
| SMILES | CCC(F)(F)C(F)(CC)C(F)(F)OC(F)(F)C(F)(CC)C(F)(F)CC |
| InChI | InChI=1S/C14H20F10O/c1-5-9(15,11(17,18)7-3)13(21,22)25-14(23,24)10(16,6-2)12(19,20)8-4/h5-8H2,1-4H3 |
| InChIKey | WFEUEWGNGBLXQR-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |