C21H20F6N2O2 — CID 88857869
6-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine (PubChem CID 88857869) has the molecular formula C21H20F6N2O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is 6-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 88857869 |
| Molecular Formula | C21H20F6N2O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 6-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-2,4-dihydro-1,3-benzoxazin-6-yl)propan-2-yl]-3-methyl-2,4-dihydro-1,3-benzoxazine |
| SMILES | CN1COc2ccc(C(c3ccc4c(c3)CN(C)CO4)(C(F)(F)F)C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C21H20F6N2O2/c1-28-9-13-7-15(3-5-17(13)30-11-28)19(20(22,23)24,21(25,26)27)16-4-6-18-14(8-16)10-29(2)12-31-18/h3-8H,9-12H2,1-2H3 |
| InChIKey | LTRXHPGBXYAIMV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |