About (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde
(2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde (PubChem CID 88857910) has the molecular formula C11H11FO2
and a molecular weight of 194.21 g/mol. Its IUPAC name is (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde.
Molecular Properties
| Compound Name | (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde |
| PubChem CID | 88857910 |
| Molecular Formula | C11H11FO2 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde |
| SMILES | C[C@]1(C=O)CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C11H11FO2/c1-11(7-13)5-4-8-6-9(12)2-3-10(8)14-11/h2-3,6-7H,4-5H2,1H3/t11-/m1/s1 |
| InChIKey | OHKMXPJQMZEJNJ-LLVKDONJSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde?
The IUPAC name of (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde (CID 88857910) is (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde.
What is the SMILES notation for (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde?
The canonical SMILES for (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde is C[C@]1(C=O)CCc2cc(F)ccc2O1.
What is the InChIKey of (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde?
The InChIKey is OHKMXPJQMZEJNJ-LLVKDONJSA-N. The full InChI is InChI=1S/C11H11FO2/c1-11(7-13)5-4-8-6-9(12)2-3-10(8)14-11/h2-3,6-7H,4-5H2,1H3/t11-/m1/s1.
What are the key properties of (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde?
(2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde has a molecular weight of 194.21 g/mol, XLogP of 2.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6-fluoro-2-methyl-3,4-dihydrochromene-2-carbaldehyde is sourced from PubChem (CID 88857910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).