C20H26F2N4O3 — CID 88857944
(Z)-N-(3,5-difluorophenyl)-2-[[(1S,2S)-2-(hydroxymethyl)cyclopropyl]methoxy]-4-imino-3-(4-methylpiperazin-1-yl)but-2-enamide (PubChem CID 88857944) has the molecular formula C20H26F2N4O3 and a molecular weight of 408.45 g/mol. Its IUPAC name is (Z)-N-(3,5-difluorophenyl)-2-[[(1S,2S)-2-(hydroxymethyl)cyclopropyl]methoxy]-4-imino-3-(4-methylpiperazin-1-yl)but-2-enamide.
| Compound Name | (Z)-N-(3,5-difluorophenyl)-2-[[(1S,2S)-2-(hydroxymethyl)cyclopropyl]methoxy]-4-imino-3-(4-methylpiperazin-1-yl)but-2-enamide |
|---|---|
| PubChem CID | 88857944 |
| Molecular Formula | C20H26F2N4O3 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (Z)-N-(3,5-difluorophenyl)-2-[[(1S,2S)-2-(hydroxymethyl)cyclopropyl]methoxy]-4-imino-3-(4-methylpiperazin-1-yl)but-2-enamide |
| SMILES | [H]/N=C/C(=C(/OC[C@H]1C[C@@H]1CO)C(=O)Nc1cc(F)cc(F)c1)N1CCN(C)CC1 |
| InChI | InChI=1S/C20H26F2N4O3/c1-25-2-4-26(5-3-25)18(10-23)19(29-12-14-6-13(14)11-27)20(28)24-17-8-15(21)7-16(22)9-17/h7-10,13-14,23,27H,2-6,11-12H2,1H3,(H,24,28)/b19-18-,23-10+/t13-,14-/m1/s1 |
| InChIKey | XQYWDLBVTHJFRP-CSZMNZSNSA-N |
| XLogP | 1.66 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|