C22H40F4O7Si — CID 88858019
1-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 5-O-(3,3,5,5-tetrafluorohexyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 88858019) has the molecular formula C22H40F4O7Si and a molecular weight of 520.63 g/mol. Its IUPAC name is 1-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 5-O-(3,3,5,5-tetrafluorohexyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 5-O-(3,3,5,5-tetrafluorohexyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 88858019 |
| Molecular Formula | C22H40F4O7Si |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 1-O-[3-[hydroxymethyl(dimethoxy)silyl]propyl] 5-O-(3,3,5,5-tetrafluorohexyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCC[Si](CO)(OC)OC)C(=O)OCCC(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C22H40F4O7Si/c1-8-20(4,18(29)33-12-10-22(25,26)15-21(5,23)24)14-19(2,3)17(28)32-11-9-13-34(16-27,30-6)31-7/h27H,8-16H2,1-7H3 |
| InChIKey | RCIZSRDUPDJNQF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|